ChemNet > CAS > 82140-55-4 methyl 2-[(2,6-dichloro-4-pyridyl)carbonyl]-3-(methylamino)but-2-enoate
82140-55-4 methyl 2-[(2,6-dichloro-4-pyridyl)carbonyl]-3-(methylamino)but-2-enoate
상품명칭 |
methyl 2-[(2,6-dichloro-4-pyridyl)carbonyl]-3-(methylamino)but-2-enoate |
영문 이름 |
methyl 2-[(2,6-dichloro-4-pyridyl)carbonyl]-3-(methylamino)but-2-enoate;methyl (2Z)-2-[(2,6-dichloropyridin-4-yl)carbonyl]-3-(methylamino)but-2-enoate; methyl 2-[(2,6-dichloropyridin-4-yl)carbonyl]-3-(methylamino)but-2-enoate |
분자식 |
C12H12Cl2N2O3 |
분자량 |
303.1413 |
InChI |
InChI=1/C12H12Cl2N2O3/c1-6(15-2)10(12(18)19-3)11(17)7-4-8(13)16-9(14)5-7/h4-5,15H,1-3H3 |
cas번호 |
82140-55-4 |
분자 구조 |
|
밀도 |
1.34g/cm3 |
녹는 점 |
112℃ |
비등점 |
462.9°C at 760 mmHg |
굴절 지수 |
1.553 |
인화점 |
233.8°C |
증기압 |
9.48E-09mmHg at 25°C |
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|